CAS 156586-91-3
:ethyl (3S)-3-({4-[(4-carbamimidoylphenyl)amino]-4-oxobutanoyl}amino)pent-4-ynoate hydrochloride
Description:
Ethyl (3S)-3-({4-[(4-carbamimidoylphenyl)amino]-4-oxobutanoyl}amino)pent-4-ynoate hydrochloride, with the CAS number 156586-91-3, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester, a pent-4-ynoate moiety, and a carbamimidoylphenyl group. This compound features a chiral center at the 3-position, indicating that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions. The presence of the hydrochloride indicates that it is a salt form, which can enhance its solubility in aqueous solutions, making it suitable for various pharmaceutical applications. The compound may exhibit properties such as potential anti-cancer or anti-inflammatory activities, as suggested by its structural components, which are often associated with bioactive molecules. However, detailed studies would be necessary to fully elucidate its pharmacological profile and therapeutic potential. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H23ClN4O4
InChI:InChI=1/C18H22N4O4.ClH/c1-3-13(11-17(25)26-4-2)21-15(23)9-10-16(24)22-14-7-5-12(6-8-14)18(19)20;/h1,5-8,13H,4,9-11H2,2H3,(H3,19,20)(H,21,23)(H,22,24);1H/t13-;/m1./s1
Synonyms:- 4-pentynoic acid, 3-[[4-[[4-(aminoiminomethyl)phenyl]amino]-1,4-dioxobutyl]amino]-, ethyl ester, (3S)-, hydrochloride (1:1)
- Ethyl (3S)-3-({4-[(4-carbamimidoylphenyl)amino]-4-oxobutanoyl}amino)pent-4-ynoate hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Xemilofiban hydrochloride
CAS:<p>Xemilofiban hydrochloride is a biochemical.</p>Formula:C18H23ClN4O4Color and Shape:SolidMolecular weight:394.85
