CAS 156640-23-2

1,2,5-Trihydroxy-9H-xanthen-9-one

Description:

1,2,5-Trihydroxy-9H-xanthen-9-one, with the CAS number 156640-23-2, is a chemical compound belonging to the xanthenone class, characterized by a xanthene core structure. This compound features three hydroxyl (-OH) groups at the 1, 2, and 5 positions, contributing to its hydrophilicity and potential for forming hydrogen bonds. The presence of these hydroxyl groups can influence its solubility in various solvents, typically enhancing solubility in polar solvents. 1,2,5-Trihydroxy-9H-xanthen-9-one may exhibit interesting photophysical properties, making it a candidate for applications in dye chemistry, fluorescence, and possibly as a biological probe. Additionally, the compound's structure suggests potential antioxidant properties, which could be explored in various biochemical contexts. Its stability and reactivity can be influenced by the pH of the environment, and it may participate in various chemical reactions typical of phenolic compounds. Overall, this compound's unique structural features and functional groups make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₃H₈O₅

InChI: InChI=1S/C13H8O5/c14-7-4-5-9-10(12(7)17)11(16)6-2-1-3-8(15)13(6)18-9/h1-5,14-15,17H

InChI key: InChIKey=WRYMABXVDKBFIK-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC=3C1=CC=CC3O)=CC=C(O)C2O

Synonyms:

• 1,2,5-Trihydroxy-9H-xanthen-9-one
• 1,2,5-Trihydroxyxanthone
• 9H-Xanthen-9-one, 1,2,5-trihydroxy-

9H-Xanthen-9-one, 1,2,5-trihydroxy-

CAS: 156640-23-2

Formula: C₁₃H₈O₅

Molecular weight: 244.1996

Ref: IN-DA01Q9CR

1,2,5-Trihydroxyxanthone

CAS: 156640-23-2

1,2,5-Trihydroxyxanthone has antioxidative properties.

Formula: C₁₃H₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 244.202

Ref: TM-TN2483

1,2,5-Trihydroxyxanthone

CAS: 156640-23-2

1,2,5-Trihydroxyxanthone is a naturally occurring compound, which is derived from certain plant species. It is primarily obtained from sources like the roots and bark of specific plants, particularly those in the family Gentianaceae. The compound exhibits a mode of action that involves free radical scavenging, attributing to its potential antioxidant properties. This mechanism enables it to neutralize reactive oxygen species, thereby mitigating oxidative stress within biological systems.

Formula: C₁₃H₈O₅

Purity: Min. 95%

Molecular weight: 244.2 g/mol

Ref: 3D-GGA64023