
CAS 15667-24-0
:1-(Hydroxymethyl)-2-imidazolidinone
Description:
1-(Hydroxymethyl)-2-imidazolidinone, with the CAS number 15667-24-0, is a chemical compound characterized by its imidazolidinone structure, which features a five-membered ring containing two nitrogen atoms and a hydroxymethyl group. This compound is typically a white to off-white solid and is soluble in water and various organic solvents, making it versatile for different applications. It exhibits properties such as being a potential intermediate in organic synthesis and may have applications in pharmaceuticals and agrochemicals due to its ability to participate in various chemical reactions. The presence of the hydroxymethyl group can influence its reactivity and interactions with other molecules, potentially enhancing its biological activity. Additionally, the compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 1-(Hydroxymethyl)-2-imidazolidinone is of interest in both academic research and industrial applications, particularly in the development of new materials and therapeutic agents.
Formula:C4H8N2O2
InChI:InChI=1S/C4H8N2O2/c7-3-6-2-1-5-4(6)8/h7H,1-3H2,(H,5,8)
InChI key:InChIKey=XQCHHZHVJHXGCM-UHFFFAOYSA-N
SMILES:C(O)N1C(=O)NCC1
Synonyms:- 2-Imidazolidinone, 1-(hydroxymethyl)-
- SRAU
- 1-(Hydroxymethyl)-2-imidazolidinone
- Monomethylolethyleneurea
- 1-Hydroxymethyl-2-imidazolidone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
