CymitQuimica logo

CAS 156731-40-7

:

Carbamic acid, 3-butenyl-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, 3-butenyl-, 1,1-dimethylethyl ester, also known by its CAS number 156731-40-7, is an organic compound characterized by its ester functional group derived from carbamic acid. This compound features a butenyl chain, which contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the 1,1-dimethylethyl group enhances its steric hindrance, influencing its chemical behavior and interactions. This ester is often utilized in various chemical processes, including as an intermediate in the synthesis of other organic compounds. Its properties may include moderate solubility in organic solvents and low solubility in water, which is common for many esters. Safety data should be consulted for handling and storage, as it may pose risks such as irritation or toxicity. Overall, this compound is of interest in both industrial and research settings due to its unique structural features and potential utility in chemical reactions.
Formula:C9H17NO2
InChI:InChI=1S/C9H17NO2/c1-5-6-7-10-8(11)12-9(2,3)4/h5H,1,6-7H2,2-4H3,(H,10,11)
InChI key:YWSXTMBDIBZHBB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCCC=C
Found 4 products.