CAS 15674-58-5
:Delphinidin 3-rutinoside
Description:
Delphinidin 3-rutinoside is a naturally occurring anthocyanin, a type of flavonoid pigment found in various fruits and vegetables, contributing to their vibrant colors. It is characterized by its deep red to purple hue, which is pH-dependent, shifting in color with changes in acidity. This compound is known for its antioxidant properties, which can help combat oxidative stress in biological systems. Delphinidin 3-rutinoside is soluble in water and exhibits stability under neutral pH conditions, although it can degrade under extreme pH levels or prolonged exposure to light and heat. Its structure consists of a delphinidin aglycone linked to a rutinoside sugar moiety, enhancing its solubility and bioavailability. This compound has been studied for its potential health benefits, including anti-inflammatory and anti-cancer effects, making it of interest in nutritional and pharmaceutical research. Additionally, it plays a role in plant pigmentation, attracting pollinators and contributing to the visual appeal of various edible plants.
Formula:C27H31O16·Cl
InChI:InChI=1S/C27H30O16.ClH/c1-8-18(32)21(35)23(37)26(40-8)39-7-17-20(34)22(36)24(38)27(43-17)42-16-6-11-12(29)4-10(28)5-15(11)41-25(16)9-2-13(30)19(33)14(31)3-9;/h2-6,8,17-18,20-24,26-27,32,34-38H,7H2,1H3,(H4-,28,29,30,31,33);1H/t8-,17+,18-,20+,21+,22-,23+,24+,26+,27+;/m0./s1
InChI key:InChIKey=ZOQQFMKYEOHRMC-KFOCXKDFSA-N
SMILES:O(C=1C(=[O+]C2=C(C1)C(O)=CC(O)=C2)C3=CC(O)=C(O)C(O)=C3)[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@H]4O.[Cl-]
Synonyms:- 1-Benzopyrylium, 3-[[6-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
- 1-Benzopyrylium, 3-[[6-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
- 3-O-Rutinosyldelphinidin
- 3′,4′,5,5′,7-Pentahydroxy-3-[(6-O-α-<span class="text-smallcaps">L</smallcap>-rhamnosyl-β-<smallcap>D</span>-glucosyl)oxy]flavylium chloride
- 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium-3-yl 6-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside chloride
- D-Ribofuranose-5-P, Ba2
- D-Ribose 5-Phosphate, Barium Salt
- D-Ribose-5-Phosphate, Barium
- Delphinidin 3-O-rutinoside
- Delphinidin 3-rutinoside
- Flavylium, 3-[[6-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-3′,4′,5,5′,7-pentahydroxy-, chloride
- R-5-P-Ba
- Tulipanin
- 1-Benzopyrylium, 3-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride (1:1)
- 1-Benzopyrylium, 3-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-, chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Delphinidin-3-O-rutinoside chloride
CAS:Delphinidin-3-O-rutinoside chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C27H31O16ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:646.98Delphinidin 3-rutinoside chloride
CAS:Delphinidin 3-rutinoside chloride is a natural anthocyanin exhibiting pro-apoptotic effects on B-cell chronic lymphocytic leukaemia (B-CLL) cells.Formula:C27H31ClO16Purity:98%Color and Shape:SolidMolecular weight:646.98Delphinidin 3-rutinoside chloride
CAS:Natural glycosideFormula:C27H31O16ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:646.99Delphinidin 3-O-rutinoside chloride
CAS:Delphinidin 3-O-rutinoside chloride is an anthocyanin pigment, which is primarily extracted from plant sources, such as flowers and fruits, where it contributes to their vivid coloration. This compound functions by interacting with various biological molecules, displaying antioxidant, anti-inflammatory, and potential therapeutic activities. As a flavonoid, it plays a significant role in the scavenging of free radicals and modulation of oxidative stress pathways.
Formula:C27H31ClO16Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:646.98 g/mol




