CAS 156772-60-0

2,5-Dibromo-3-fluoropyridine

Description:

2,5-Dibromo-3-fluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two bromine atoms and one fluorine atom. The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The bromine atoms can participate in nucleophilic substitution reactions, while the fluorine atom can enhance the compound's lipophilicity and stability. Additionally, 2,5-Dibromo-3-fluoropyridine may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as halogenated pyridines can be toxic and environmentally hazardous. Proper storage and disposal methods are essential to mitigate any risks associated with its use.

Formula: C₅H₂Br₂FN

InChI: InChI=1/C5H2Br2FN/c6-3-1-4(8)5(7)9-2-3/h1-2H

SMILES: c1c(cnc(c1F)Br)Br

Synonyms:

• Pyridine, 2,5-dibromo-3-fluoro-

Pyridine, 2,5-dibromo-3-fluoro-

CAS: 156772-60-0

Formula: C₅H₂Br₂FN

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.8825

Ref: IN-DA001OZ7

2,5-Dibromo-3-fluoropyridine

CAS: 156772-60-0

Purity: 95%

Molecular weight: 254.882

Ref: FT-D12701

2,5-Dibromo-3-fluoropyridine

CAS: 156772-60-0

2,5-Dibromo-3-fluoropyridine

Formula: C₅H₂Br₂FN

Purity: 98%

Color and Shape: white to off-white solid

Molecular weight: 254.88g/mol

Ref: 54-PC6077

2,5-Dibromo-3-fluoropyridine

CAS: 156772-60-0

Formula: C₅H₂Br₂FN

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.884

Ref: 10-F212131