CAS 156772-63-3

5-BROMO-3-FLUORO-2-PYRIDINONE

Description:

5-Bromo-3-fluoro-2-pyridinone is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine and fluorine atoms, as well as a keto group. Its molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential reactivity. The presence of the bromine and fluorine substituents can influence the compound's electronic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is often utilized in medicinal chemistry and pharmaceutical research due to its potential biological activity. It may exhibit properties such as antimicrobial or anti-inflammatory effects, depending on its interactions with biological targets. Additionally, the compound's solubility and stability can be affected by the substituents, which is crucial for its application in drug formulation. Overall, 5-bromo-3-fluoro-2-pyridinone is a valuable compound in synthetic organic chemistry and drug discovery, with its unique characteristics stemming from its specific molecular structure.

Formula: C₅H₃BrFNO

InChI: InChI=1/C5H3BrFNO/c6-3-1-4(7)5(9)8-2-3/h1-2H,(H,8,9)

SMILES: c1c(cnc(c1F)O)Br

Synonyms:

• 2(1H)-Pyridinone, 5-bromo-3-fluoro-
• 2-Pyridinol, 5-Bromo-3-Fluoro-
• 5-Bromo-3-fluoropyridin-2(1H)-one
• 5-Bromo-3-fluoropyridin-2-ol
• 5-Bromo-3-fluoro-2-hydroxypyridine

5-Bromo-3-fluoropyridin-2-ol

CAS: 156772-63-3

Formula: C₅H₃BrFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.9858

Ref: IN-DA001OZ6

5-Bromo-3-fluoro-2-hydroxypyridine

CAS: 156772-63-3

5-Bromo-3-fluoro-2-hydroxypyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.99g/mol

Ref: 54-PC445022

5-Bromo-3-fluoropyridin-2(1H)-one

CAS: 156772-63-3

Formula: C₅H₃BrFNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.987

Ref: 10-F226049