
CAS 156774-73-1
:(2E)-3-(6-Nitro-1,3-benzodioxol-5-yl)-2-propenoic acid
Description:
(2E)-3-(6-Nitro-1,3-benzodioxol-5-yl)-2-propenoic acid, with CAS number 156774-73-1, is an organic compound characterized by its unique structural features, including a propenoic acid backbone and a nitro-substituted benzodioxole moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the nitro group suggests that it may participate in electrophilic reactions, while the propenoic acid functionality indicates potential for polymerization or conjugation reactions. Its solubility is likely influenced by the balance between the hydrophilic nitro group and the hydrophobic aromatic system. Additionally, the compound may exhibit interesting optical properties due to its conjugated double bond system. As with many nitro-containing compounds, it may also possess biological activity, making it of interest in medicinal chemistry and pharmacology. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.
Formula:C10H7NO6
InChI:InChI=1S/C10H7NO6/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15/h1-4H,5H2,(H,12,13)/b2-1+
InChI key:InChIKey=GJAIAEVUUHUHTE-OWOJBTEDSA-N
SMILES:C(=C/C(O)=O)\C1=C(N(=O)=O)C=C2C(=C1)OCO2
Synonyms:- 2-Propenoic acid, 3-(6-nitro-1,3-benzodioxol-5-yl)-, (E)-
- 2-Propenoic acid, 3-(6-nitro-1,3-benzodioxol-5-yl)-, (2E)-
- (2E)-3-(6-Nitro-1,3-benzodioxol-5-yl)-2-propenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(2E)-3-(6-Nitro-1,3-dioxaindan-5-yl)prop-2-enoic acid
CAS:(2E)-3-(6-Nitro-1,3-dioxaindan-5-yl)prop-2-enoic acid is a high yield modification of the natural product taxol. It has been shown to enhance the anticancer activity of taxol in vitro and in vivo with modifications to the drug structure. This compound inhibits proliferation by binding to cell cycle regulators, such as cyclin D1 and CDK4, which are required for cell growth. (2E)-3-(6-Nitro-1,3-dioxaindan-5-yl)prop-2-enoic acid also inhibits the production of phenylpropanoid compounds and enhances the production of taxanes, two classes of plant cell growth regulators that have been shown to induce plant cell growth.
Formula:C10H7NO6Purity:Min. 95%Molecular weight:237.17 g/mol
