CAS 15684-36-3
:Borate(1-), tetrafluoro-, nickel(2+) (2:1), hexahydrate
Description:
Borate(1-), tetrafluoro-, nickel(2+) (2:1), hexahydrate, with the CAS number 15684-36-3, is a coordination compound featuring nickel in a +2 oxidation state coordinated with tetrafluoroborate anions. This compound typically appears as a crystalline solid and is characterized by its hexahydrate form, indicating the presence of six water molecules associated with each formula unit. The tetrafluoroborate anion contributes to the compound's unique properties, including its potential use in various chemical applications, such as catalysis and materials science. The presence of nickel, a transition metal, imparts specific electronic and magnetic properties, making it of interest in fields like coordination chemistry and materials development. Additionally, the hexahydrate form suggests that the compound is soluble in water, which can influence its reactivity and interaction with other substances. Overall, this compound exemplifies the diverse chemistry of transition metal complexes and their potential applications in industrial and research settings.
Formula:BF4·3H2ONi
InChI:InChI=1S/BF4.Ni.3H2O/c2-1(3,4)5;;;;/h;;3*1H2/q-1;+2;;;
InChI key:InChIKey=ZUWUTEXLDCCHIA-UHFFFAOYSA-N
SMILES:[B+3]([F-])([F-])([F-])[F-].[Ni+2].O
Synonyms:- Borate(1-), tetrafluoro-, nickel(2+) (2:1), hexahydrate
- Borate(1-), tetrafluoro-, nickel(2+), hexahydrate
- Nickel(2+) bis[tetrafluoroborate(1-)] hexahydrate
- Nickel(II) ditetrafluoroborate hexahydrate
- Nickel tetrafluoroborate hexahydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Nickel(II) tetrafluoroborate hexahydrate
CAS:<p>It is mainly used as an electroplating intermediate. It is also used in medical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / </p>Formula:B2F8H12NiO6Molecular weight:340.39Nickel(II) tetrafluoroborate hexahydrate, 99%
CAS:<p>Nickel(II) tetrafluoroborate hexahydrate, 99%</p>Formula:Ni(BF4)2·6H2OPurity:99%Color and Shape:green xtl.Molecular weight:232.23 (340.32)Borate(1-), tetrafluoro-, nickel(2+) (2:1), hexahydrate (9CI)
CAS:Formula:BF4H2NiOPurity:97%Color and Shape:SolidMolecular weight:163.5133Nickel(II) tetrafluoroborate hexahydrate
CAS:Nickel(II) tetrafluoroborate hexahydratePurity:98%Color and Shape:Green CrystalsMolecular weight:340.39g/molNickel tetrafluoroborate hexahydrate
CAS:Formula:B2F8H12NiO6Purity:98.0%Color and Shape:SolidMolecular weight:340.39




