CAS 156867-73-1

5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 156867-73-1, is a chemical compound characterized by its triazole core, which is a five-membered ring containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of the 4-chloro-3,5-dimethylphenoxy group suggests that it may exhibit hydrophobic properties, which can influence its solubility and interaction with biological membranes. The compound's structure implies potential applications in agricultural chemistry, particularly as a fungicide or herbicide, due to the presence of the triazole moiety, which is commonly associated with antifungal activity. Additionally, the specific substitutions on the aromatic ring may enhance its efficacy and selectivity. Overall, this compound's unique structural features position it as a candidate for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₄ClN₃OS

InChI: InChI=1/C12H14ClN3OS/c1-7-4-9(5-8(2)11(7)13)17-6-10-14-15-12(18)16(10)3/h4-5H,6H2,1-3H3,(H,15,18)

SMILES: Cc1cc(cc(C)c1Cl)OCc1nnc(n1C)S

5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 156867-73-1

Formula: C₁₂H₁₄ClN₃OS

Purity: 95.0%

Molecular weight: 283.77

Ref: 10-F307785