CAS 1569-16-0
:2-METHYL-[1,8]NAPHTHYRIDINE
Description:
2-Methyl-[1,8]naphthyridine, with the CAS number 1569-16-0, is a heterocyclic organic compound characterized by a fused ring system that includes both naphthalene and pyridine structures. This compound features a methyl group attached to the nitrogen-containing naphthyridine ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of the nitrogen atom in the ring structure imparts basicity and potential reactivity, making it of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 2-methyl-[1,8]naphthyridine may participate in various chemical reactions, such as electrophilic substitutions or coordination with metal ions, due to its aromatic nature and nitrogen functionality. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H8N2
InChI:InChI=1/C9H8N2/c1-7-4-5-8-3-2-6-10-9(8)11-7/h2-6H,1H3
SMILES:Cc1ccc2cccnc2n1
Synonyms:- Akos Bbs-00006025
- 2-Methylpyrido[2,3-b]pyridine
- 2-Methyl-1,8-naphthyridine,97%
- 2-Methyl-1,8-diazanaphthalene
- -1,8-naphthyridine
- 2-METHYL-[1,8]NAPHTHYRIDINE
- 1,8-Naphthyridine, 2-methyl-
- 2-Methyl-1,8-naphthyridine>
- 2-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-5,5-dimethylcyclohexane-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Methyl-1,8-naphthyridine
CAS:Formula:C9H8N2Purity:>98.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:144.182-Methyl-1,8-naphthyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H8N2Purity:97%Color and Shape:Orange to brown, PowderMolecular weight:144.181,8-Naphthyridine, 2-methyl-
CAS:Formula:C9H8N2Purity:96%Color and Shape:SolidMolecular weight:144.1732Ref: IN-DA001P2U
1g26.00€5g50.00€10g75.00€1kgTo inquire25g138.00€5kgTo inquire100g515.00€500gTo inquire250mg22.00€2-Methyl[1,8]-Naphthyridine
CAS:Formula:C9H8N2Purity:97.0%Color and Shape:SolidMolecular weight:144.1772-Methyl-[1,8]naphthyridine
CAS:2-Methyl-[1,8]naphthyridineFormula:C9H8N2Purity:98%Color and Shape: brown solidMolecular weight:144.17g/mol




