CAS 1569-59-1
:3-Methyl-4-penten-2-ol
Description:
3-Methyl-4-penten-2-ol, with the CAS number 1569-59-1, is an organic compound characterized by its structure, which features a five-carbon chain with a hydroxyl (-OH) group and a double bond. This compound belongs to the class of alcohols and is classified as an unsaturated alcohol due to the presence of a double bond between the carbon atoms. It is typically a colorless liquid with a distinctive odor, and it is soluble in organic solvents. The presence of both the double bond and the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as dehydration and oxidation. 3-Methyl-4-penten-2-ol can be used as an intermediate in organic synthesis and may have applications in the production of fragrances or flavoring agents. Its physical and chemical properties, such as boiling point and density, can vary based on environmental conditions and purity. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H12O
InChI:InChI=1S/C6H12O/c1-4-5(2)6(3)7/h4-7H,1H2,2-3H3
InChI key:InChIKey=COIPQIFWUIDWLU-UHFFFAOYSA-N
SMILES:C(C(C)O)(C=C)C
Synonyms:- 3-Methylpent-4-en-2-ol
- 4-Penten-2-ol, 3-methyl-
- 3-Methyl-4-penten-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
