CAS 15690-55-8
:Zuclomiphene
Description:
Zuclomiphene, with the CAS number 15690-55-8, is a chemical compound that belongs to the class of selective estrogen receptor modulators (SERMs). It is primarily known for its use in the treatment of conditions related to estrogen deficiency, such as infertility and certain types of breast cancer. Zuclomiphene exhibits both estrogenic and anti-estrogenic properties, depending on the target tissue, which allows it to modulate estrogen activity effectively. The compound is characterized by its ability to bind to estrogen receptors, influencing gene expression and cellular responses. Its pharmacological profile includes promoting ovulation in women with anovulatory disorders while potentially inhibiting estrogen effects in breast tissue. Zuclomiphene is typically administered orally and is recognized for its relatively favorable side effect profile compared to other estrogenic therapies. As with any medication, its use should be guided by a healthcare professional, considering individual patient factors and potential interactions with other drugs.
Formula:C26H28ClNO
InChI:InChI=1S/C26H28ClNO/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3/b26-25-
InChI key:InChIKey=GKIRPKYJQBWNGO-QPLCGJKRSA-N
SMILES:C(=C(\Cl)/C1=CC=CC=C1)(\C2=CC=C(OCCN(CC)CC)C=C2)/C3=CC=CC=C3
Synonyms:- (Z)-Clomiphene
- 2-[4-[(1Z)-2-Chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethylethanamine
- Ethanamine, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-, (Z)-
- Ethanamine, 2-[4-[(1Z)-2-chloro-1,2-diphenylethenyl]phenoxy]-N,N-diethyl-
- Rmi 16312
- Transclomifene
- Triethylamine, 2-[p-(2-chloro-1,2-diphenylvinyl)phenoxy]-, (Z)-
- Zuclomiphene
- cis-Clomifene
- cis-Clomiphene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
cis-Clomiphene (Zuclomiphene)
CAS:Formula:C26H28ClNOColor and Shape:White To Off-White SolidMolecular weight:405.97Zuclomiphene
CAS:Controlled ProductZuclomiphene is a selective estrogen receptor modulator (SERM), which is derived from clomiphene citrate, a mixture containing two isomers, zuclomiphene and enclomiphene. Zuclomiphene acts by binding to estrogen receptors, exhibiting both estrogenic and anti-estrogenic effects depending on the target tissue. This dual action makes it a valuable tool in modulating estrogen receptor activity for scientific research.
Formula:C26H28ClNOPurity:Min. 95%Molecular weight:405.96 g/molZuclomiphene
CAS:Zuclomiphene is a nonsteroidal selective estrogen receptor modulator (SERM) with triphenylethylene group.Formula:C26H28ClNOPurity:98%Color and Shape:SolidMolecular weight:405.96



