CAS 156939-62-7

(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate

Description:

(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate, with the CAS number 156939-62-7, is a chemical compound characterized by its unique structure that includes a fluorenyl group, which contributes to its aromatic properties, and a carbamate functional group that is known for its reactivity and ability to form hydrogen bonds. This compound typically exhibits moderate solubility in organic solvents, reflecting its hydrophobic fluorenyl moiety. The presence of the 2-oxoethyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, (9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₇H₁₅NO₃

InChI: InChI=1/C17H15NO3/c19-10-9-18-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,10,16H,9,11H2,(H,18,20)

SMILES: c1ccc2c(c1)c1ccccc1C2COC(=NCC=O)O

Synonyms:

• 9H-Fluoren-9-ylmethyl (2-oxoethyl)carbamate
• carbamic acid, N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester

Carbamic acid, N-(2-oxoethyl)-, 9H-fluoren-9-ylmethyl ester

CAS: 156939-62-7

Formula: C₁₇H₁₅NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 281.3059

Ref: IN-DA001P4B

(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate

CAS: 156939-62-7

(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate

Purity: 95%

Molecular weight: 281.31g/mol

Ref: 54-OR74649

(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate

CAS: 156939-62-7

Formula: C₁₇H₁₅NO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 281.311

Ref: 10-F235200