CAS 156973-09-0
:6-Amino-3-Pyridinemethanamine
Description:
6-Amino-3-pyridinemethanamine, with the CAS number 156973-09-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an amino group (-NH2) and a methanamine group (-CH2NH2) attached to the pyridine ring, contributing to its basicity and potential reactivity. It is typically a solid at room temperature and may be soluble in polar solvents due to the presence of the amino groups, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for pharmaceuticals or as a ligand in coordination chemistry. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H9N3
InChI:InChI=1/C6H9N3/c7-3-5-1-2-6(8)9-4-5/h1-2,4H,3,7H2,(H2,8,9)
SMILES:c1cc(=N)[nH]cc1CN
Synonyms:- 5-(Aminomethyl)Pyridin-2-Amine
- 3-Pyridinemethanamine, 6-amino-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Pyridinemethanamine, 6-amino-
CAS:Formula:C6H9N3Purity:95%Color and Shape:SolidMolecular weight:123.15582-Amino-5-(aminomethyl)pyridine
CAS:2-Amino-5-(aminomethyl)pyridinePurity:95%Color and Shape:Off-White SolidMolecular weight:123.16g/mol5-(Aminomethyl)pyridin-2-amine
CAS:5-(Aminomethyl)pyridin-2-amine (5-APA) is a chemical compound with the molecular formula CHClN. 5-APA is an organic base that can be used as a solvent, such as in the extraction of metals and other compounds. It is also used to make other chemicals, including pharmaceuticals, solvents, and dyes. 5-APA is soluble in water and reacts with acids to form hydrogen chloride gas and ammonia gas. The product can evaporate when heated. The boiling point of 5-APA is -13°C and its melting point is -1°C. Its density at 20°C is 1.6 g/mL and it has a specific gravity of 1.856 at 20°C. 5-APA has a vapor pressure of 7 mm Hg at 25°C. It has a diameter of 0.906 cm at 25°C and a flow rate ofFormula:C6H9N3Purity:Min. 95%Molecular weight:123.16 g/mol



