CAS 156980-60-8
:Grosvenorine
Description:
Grosvenorine, with the CAS number 156980-60-8, is a chemical compound that belongs to the class of alkaloids. It is derived from natural sources, specifically from certain plant species. Grosvenorine is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its mechanism of action may involve interactions with specific receptors or enzymes in biological systems. Additionally, Grosvenorine's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. As with many alkaloids, the safety profile and toxicity of Grosvenorine are critical considerations for its use in any medicinal context, necessitating thorough investigation and evaluation in preclinical studies.
Formula:C33H40O19
InChI:InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(46-10)51-29-22(40)18-15(36)7-14(8-16(18)49-28(29)12-3-5-13(35)6-4-12)48-33-30(25(43)20(38)11(2)47-33)52-32-27(45)24(42)21(39)17(9-34)50-32/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21+,23+,24-,25+,26+,27+,30+,31-,32-,33-/m0/s1
InChI key:FFGGWIVHOGEVSP-NWQOLJAQSA-N
SMILES:C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC=C(C=C6)O)O)O)O
Synonyms:- Grosvenorin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Grosvenorine (Standard)
CAS:Grosvenorine (Standard) is a reference standard for research and analysis in studies involving Grosvenorine. Grosvenorine (Grosvenorin) exhibits good antibacterial and antioxidant activities, with its metabolites possessing more potent activities, intestinal bacteria play an important role in the gastrointestinal metabolism of grosvenorine and significantly affect its pharmacological activities.Formula:C33H40O19Molecular weight:740.66Grosvenorine
CAS:Grosvenorine shows antibacterial, antioxidant properties; metabolites stronger; gut bacteria key to its effects.Formula:C33H40O19Purity:99.53% - 99.6%Color and Shape:SolidMolecular weight:740.66Ref: TM-TN1714
1mg92.00€5mg192.00€1mL*10mM (DMSO)245.00€10mg295.00€25mg497.00€50mg708.00€100mg964.00€Grosvenorine
CAS:7-(((2S,3R,4R,5R,6S)-4,5-Dihydroxy-6-methyl-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-5-hydroxy-2-(4-hydroxyphenyl)-3-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-oneFormula:C33H40O19Purity:99%Molecular weight:740.66Grosvenorine
CAS:Grosvenorine is a biochemical compound, which is a natural glycoside extracted from the fruit of Siraitia grosvenorii, commonly known as monk fruit. This compound is primarily sourced from the cucurbitaceae family of plants, renowned for their sweet-tasting fruits. The mode of action of grosvenorine involves its interaction with various metabolic pathways, exhibiting antioxidant and anti-inflammatory properties.Purity:Min. 95%








