CAS 156980-60-8

Grosvenorine

Description:

Grosvenorine, with the CAS number 156980-60-8, is a chemical compound that belongs to the class of alkaloids. It is derived from natural sources, specifically from certain plant species. Grosvenorine is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its mechanism of action may involve interactions with specific receptors or enzymes in biological systems. Additionally, Grosvenorine's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. As with many alkaloids, the safety profile and toxicity of Grosvenorine are critical considerations for its use in any medicinal context, necessitating thorough investigation and evaluation in preclinical studies.

Formula: C₃₃H₄₀O₁₉

InChI: InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(46-10)51-29-22(40)18-15(36)7-14(8-16(18)49-28(29)12-3-5-13(35)6-4-12)48-33-30(25(43)20(38)11(2)47-33)52-32-27(45)24(42)21(39)17(9-34)50-32/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21+,23+,24-,25+,26+,27+,30+,31-,32-,33-/m0/s1

InChI key: FFGGWIVHOGEVSP-NWQOLJAQSA-N

SMILES: C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O[C@H]4[C@@H]([C@@H]([C@H]([C@@H](O4)C)O)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C6=CC=C(C=C6)O)O)O)O

Synonyms:

• Grosvenorin

Grosvenorine

CAS: 156980-60-8

Formula: C₃₃H₄₀O₁₉

Purity: 99%

Molecular weight: 740.6593

Ref: IN-DA00ALQ4

Grosvenorine

CAS: 156980-60-8

Grosvenorine

Formula: C₃₃H₄₀O₁₉

Purity: ≥95%

Molecular weight: 740.66

Ref: 54-BUP06950

Grosvenorine

CAS: 156980-60-8

Formula: C₃₃H₄₀O₁₉

Molecular weight: 740.66

Ref: 7W-GY6987

Grosvenorine (Standard)

CAS: 156980-60-8

Grosvenorine (Standard) is a reference standard for research and analysis in studies involving Grosvenorine. Grosvenorine (Grosvenorin) exhibits good antibacterial and antioxidant activities, with its metabolites possessing more potent activities, intestinal bacteria play an important role in the gastrointestinal metabolism of grosvenorine and significantly affect its pharmacological activities.

Formula: C₃₃H₄₀O₁₉

Molecular weight: 740.66

Ref: TM-TMSM-2471

Grosvenorine

CAS: 156980-60-8

Formula: C₃₃H₄₀O₁₉

Purity: 95%~99%

Molecular weight: 740.664

Ref: BP-BP1487

Grosvenorine

CAS: 156980-60-8

Grosvenorine shows antibacterial, antioxidant properties; metabolites stronger; gut bacteria key to its effects.

Formula: C₃₃H₄₀O₁₉

Purity: 99.53% - 99.6%

Color and Shape: Solid

Molecular weight: 740.66

Ref: TM-TN1714

Grosvenorine

CAS: 156980-60-8

7-(((2S,3R,4R,5R,6S)-4,5-Dihydroxy-6-methyl-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-5-hydroxy-2-(4-hydroxyphenyl)-3-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one

Formula: C₃₃H₄₀O₁₉

Purity: 99%

Molecular weight: 740.66

Ref: IN-DG766733

Grosvenorine

CAS: 156980-60-8

Natural glycoside

Formula: C₃₃H₄₀O₁₉

Purity: ≥ 95.0 % (HPLC)

Molecular weight: 740.66

Ref: 5G-84217

Grosvenorine

CAS: 156980-60-8

Formula: C₃₃H₄₀O₁₉

Molecular weight: 740.7

Ref: BE-RMT11924

Grosvenorine

CAS: 156980-60-8

Grosvenorine is a biochemical compound, which is a natural glycoside extracted from the fruit of Siraitia grosvenorii, commonly known as monk fruit. This compound is primarily sourced from the cucurbitaceae family of plants, renowned for their sweet-tasting fruits. The mode of action of grosvenorine involves its interaction with various metabolic pathways, exhibiting antioxidant and anti-inflammatory properties.

Purity: Min. 95%

Ref: 3D-FG74479