CAS 157025-33-7
:5-(Tributylstannyl)thiazole
Description:
5-(Tributylstannyl)thiazole is an organotin compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The compound features a tributylstannyl group, which consists of a tin atom bonded to three butyl groups, enhancing its lipophilicity and potential for various applications in organic synthesis and materials science. This substance is typically used in the field of organometallic chemistry and may serve as a precursor or reagent in the synthesis of other compounds. Its properties include moderate stability under ambient conditions, but it may be sensitive to moisture and air, necessitating careful handling and storage. The presence of the tin atom can impart unique reactivity, making it useful in coupling reactions and as a catalyst in polymerization processes. Additionally, due to the potential toxicity of organotin compounds, safety precautions should be observed when working with 5-(Tributylstannyl)thiazole, particularly in terms of exposure and environmental impact.
Formula:C15H29NSSn
InChI:InChI=1/3C4H9.C3H2NS.Sn/c3*1-3-4-2;1-2-5-3-4-1;/h3*1,3-4H2,2H3;1,3H;/rC15H29NSSn/c1-4-7-10-18(11-8-5-2,12-9-6-3)15-13-16-14-17-15/h13-14H,4-12H2,1-3H3
SMILES:CCCC[Sn](CCCC)(CCCC)c1cncs1
Synonyms:- Tributyl(thiazol-5-yl)stannane
- 5-(Tributylstannanyl)-1,3-Thiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Thiazole,5-(tributylstannyl)-
CAS:Formula:C15H29NSSnPurity:98%Color and Shape:LiquidMolecular weight:374.16355-(Tributylstannyl)-1,3-thiazole
CAS:5-(Tributylstannyl)-1,3-thiazoleFormula:C15H29NSSnPurity:≥95%Color and Shape: faint yellow to light yellow liquidMolecular weight:374.17g/mol5-Tributylstannylthiazole
CAS:Controlled ProductFormula:C15H29NSSnColor and Shape:NeatMolecular weight:374.1735-(Tributylstannyl)thiazole
CAS:Controlled Product5-(Tributylstannyl)thiazole is a benzothiazole that is synthesized by the reaction of 2-chlorobenzothiazole with tributyltin chloride. The compound has electrophilic, electropositive, and nucleophilic properties and can undergo nucleophilic attack. 5-(Tributylstannyl)thiazole reacts with vitamin B1 to produce an oxidative reaction. As a result, it can be used as an antioxidant in food. This compound also has electron donating properties and is electronegative.Purity:Min. 95%



