CAS 157047-97-7
:benzomalvin B
Description:
Benzomalvin B is a chemical compound classified as a natural product, specifically a type of alkaloid. It is derived from certain fungal species and is known for its complex structure, which includes multiple aromatic rings and functional groups. The compound exhibits notable biological activity, including potential antimicrobial and cytotoxic properties, making it of interest in pharmaceutical research. Its molecular structure contributes to its ability to interact with various biological targets, which may lead to therapeutic applications. Benzomalvin B is typically studied in the context of its biosynthesis, mechanisms of action, and potential uses in drug development. As with many natural products, its extraction and purification can be challenging, and ongoing research aims to elucidate its full range of biological effects and potential applications in medicine. Safety and handling precautions are essential when working with this compound, as with any bioactive substance.
Formula:C24H17N3O2
InChI:InChI=1/C24H17N3O2/c1-26-21(15-16-9-3-2-4-10-16)22-25-19-13-7-5-11-17(19)24(29)27(22)20-14-8-6-12-18(20)23(26)28/h2-15H,1H3/b21-15+
Synonyms:- Benzomalvin B
- (7E)-6-methyl-7-(phenylmethylidene)-6,7-dihydroquinazolino[3,2-a][1,4]benzodiazepine-5,13-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benzomalvin B
CAS:<p>Benzomalvin B, a metabolite from Penicillium, blocks 24% NK1 receptor binding at 100 μg/ml.</p>Formula:C24H17N3O2Color and Shape:SolidMolecular weight:379.419Benzomalvin B
CAS:<p>Benzomalvin B is an alkaloid-type compound, a secondary metabolite sourced from fungi, particularly those belonging to the Penicillium genus. It functions by interacting with cellular pathways, often targeting and interfering with cell growth and proliferation processes, which makes it a compound of interest for its potential antineoplastic properties.</p>Formula:C24H17N3O2Purity:Min. 95%Molecular weight:379.4 g/mol

