CAS 157047-98-8
:benzomalvin C
Description:
Benzomalvin C, identified by its CAS number 157047-98-8, is a chemical compound that belongs to the class of alkaloids. It is derived from natural sources, particularly from certain species of fungi. This compound is characterized by its complex molecular structure, which typically includes multiple aromatic rings and functional groups that contribute to its biological activity. Benzomalvin C has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. Its mechanism of action often involves interaction with biological macromolecules, which can disrupt cellular processes in target organisms. Additionally, the compound may exhibit varying solubility in different solvents, influencing its bioavailability and efficacy. Research into benzomalvin C continues to explore its potential applications in drug development and its role in natural product chemistry. As with many alkaloids, safety and toxicity profiles are critical areas of study to ensure its viability for therapeutic use.
Formula:C24H17N3O3
InChI:InChI=1/C24H17N3O3/c1-26-21(28)17-12-6-8-14-19(17)27-22(29)16-11-5-7-13-18(16)25-23(27)24(26)20(30-24)15-9-3-2-4-10-15/h2-14,20H,1H3
SMILES:CN1C(=O)c2ccccc2n2c(=O)c3ccccc3nc2C21C(c1ccccc1)O2
Synonyms:- 6'-methyl-3-phenyl-13'H-spiro[oxirane-2,7'-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'(6'H)-dione
- Benzomalvin C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Spiro[oxirane-2,7'(13'H)-quinazolino[3,2-a][1,4]benzodiazepine]-5',13'(6'H)-dione, 6'-methyl-3-phenyl-, (2R,3S)-rel-(+)- (9CI)
CAS:Formula:C24H17N3O3Molecular weight:395.4101Benzomalvin C
CAS:Benzomalvin C, isolated from Penicillium, inhibits NK1 receptor and IDO with IC50 of 130 μM, and has a unique epoxide group at C-19/C-20.
Formula:C24H17N3O3Color and Shape:SolidMolecular weight:395.418Benzomalvin C
CAS:Benzomalvin C is a medicinal compound that has shown promising anticancer activity. It is an analog of a protein kinase inhibitor found in Chinese urine and has been shown to inhibit the growth of cancer cells. Benzomalvin C induces apoptosis in human cancer cells by inhibiting kinases involved in tumor growth and progression. This compound has potential as a therapeutic agent for the treatment of various types of cancer. Its unique structure and mechanism of action make it a promising candidate for further research and development in the field of oncology.Formula:C24H17N3O3Purity:Min. 95%Molecular weight:395.4 g/mol



