CymitQuimica logo

CAS 157066-15-4

:

T-BUTYLTRI-N-BUTYLTIN

Description:
T-Butyltri-n-butyltin, with the CAS number 157066-15-4, is an organotin compound characterized by its tri-n-butyltin functional group attached to a t-butyl moiety. This compound typically appears as a colorless to pale yellow liquid and is known for its high molecular weight and low volatility. It exhibits hydrophobic properties, making it insoluble in water but soluble in organic solvents. T-Butyltri-n-butyltin is primarily used in various industrial applications, including as a biocide and a stabilizer in plastics, particularly polyvinyl chloride (PVC). Its chemical structure contributes to its effectiveness in these roles, as organotin compounds often possess antimicrobial properties. However, due to environmental and health concerns associated with organotin compounds, including toxicity and potential endocrine-disrupting effects, their use is regulated in many regions. Proper handling and disposal are essential to mitigate any adverse effects on human health and the environment.
Formula:C16H36Sn
InChI:InChI=1/4C4H9.Sn/c1-4(2)3;3*1-3-4-2;/h1-3H3;3*1,3-4H2,2H3;/rC16H36Sn/c1-7-10-13-17(14-11-8-2,15-12-9-3)16(4,5)6/h7-15H2,1-6H3
SMILES:CCCC[Sn](CCCC)(CCCC)C(C)(C)C
Synonyms:
  • Tributyl(Tert-Butyl)Stannane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.