CAS 1571-30-8
:8-Hydroxyquinoline-2-carboxylic acid
Description:
8-Hydroxyquinoline-2-carboxylic acid, also known as oxine-2-carboxylic acid, is an organic compound characterized by its quinoline structure, which features a hydroxyl group and a carboxylic acid group. This compound is typically a white to pale yellow crystalline solid that is soluble in water and organic solvents, reflecting its polar functional groups. It exhibits chelating properties, allowing it to form stable complexes with metal ions, which makes it useful in various applications, including analytical chemistry and biochemistry. The presence of the hydroxyl group contributes to its ability to act as a weak acid, while the carboxylic acid group enhances its reactivity. Additionally, 8-hydroxyquinoline-2-carboxylic acid has been studied for its potential biological activities, including antimicrobial and anti-inflammatory effects. Its structural features and reactivity make it a valuable compound in both research and industrial applications, particularly in the fields of coordination chemistry and materials science.
Formula:C10H7NO3
InChI:InChI=1/C10H7NO3/c12-8-3-1-2-6-4-5-7(10(13)14)11-9(6)8/h1-5,12H,(H,13,14)/p-1
InChI key:InChIKey=UHBIKXOBLZWFKM-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC(C(O)=O)=N2)C=CC1
Synonyms:- 2-Carboxy-8-hydroxyquinoline
- 2-Quinolinecarboxylic acid, 8-hydroxy-
- 8-Hydroxy-2-Quinolinecarboxylic Acid
- 8-Hydroxy-Quinaldicaci
- 8-Hydroxyquinaldic Acid
- 8-Hydroxyquinaldinic acid
- 8-Hydroxyquinoline-2-Carboxylate
- 8-Hydroxyquinoline-2-Carboxylic Acid 98%
- Methyl 8-Hydroxyquinoline-2-Carboxylate
- Quinaldic acid, 8-hydroxy-
- Rarechem Al Bo 1187
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
8-Hydroxyquinoline-2-carboxylic Acid
CAS:Formula:C10H7NO3Purity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:189.172-Quinolinecarboxylic acid, 8-hydroxy-
CAS:Formula:C10H7NO3Purity:98%Color and Shape:SolidMolecular weight:189.16758-Hydroxyquinoline-2-carboxylic acid
CAS:8-Hydroxyquinoline-2-carboxylic acidPurity:95%Molecular weight:189.17g/mol8-Hydroxyquinoline-2-carboxylic acid
CAS:8-Hydroxyquinoline-2-carboxylic acid is a 3-hydroxyanthranilic acid derivative that is often used as a biomarker of urine. The 8OHQA can be synthesized from 3-hydroxyanthranilic acid by the action of xanthine oxidase and hydrogen peroxide, and it has been shown to be an inhibitor of protein synthesis. This inhibition may be due to its ability to form hydrogen bonds with the hydroxyl group on the ribose side chain and its ability to coordinate with metals. 8OHQA has been shown to have anti-inflammatory effects in bladder cancer cells, which may be due to its ability to inhibit prostaglandin synthesis.
Formula:C10H7NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:189.17 g/mol8-Hydroxyquinoline-2-carboxylic acid
CAS:Formula:C10H7NO3Purity:95%Color and Shape:Solid, CrystallineMolecular weight:189.17BAY32-5915
CAS:BAY32-5915 is a selective inhibitor of IKKalpha.Formula:C10H7NO3Purity:96.48% - 97%Color and Shape:Yellow Crystalline PowderMolecular weight:189.17






