CAS 1571-65-9
:3-Amino-4-hydroxybenzoic acid hydrochloride
Description:
3-Amino-4-hydroxybenzoic acid hydrochloride, also known as para-aminosalicylic acid hydrochloride, is an organic compound characterized by its amino and hydroxy functional groups attached to a benzene ring. This compound is a white to off-white crystalline powder that is soluble in water, making it suitable for various pharmaceutical applications. It has a molecular formula that reflects its structure, containing both an amino group (-NH2) and a hydroxyl group (-OH), which contribute to its reactivity and biological activity. The hydrochloride form enhances its solubility and stability, facilitating its use in medicinal formulations. This compound is primarily known for its role as an antitubercular agent, particularly in the treatment of tuberculosis, and it has been utilized in combination therapies. Additionally, it exhibits properties that may influence pH and can act as a buffering agent in certain formulations. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H8ClNO3
InChI:InChI=1/C7H7NO3.ClH/c8-5-3-4(7(10)11)1-2-6(5)9;/h1-3,9H,8H2,(H,10,11);1H
SMILES:c1cc(c(cc1C(=O)O)N)O.Cl
Synonyms:- 4-Hydroxy-3-aminobenzoic acid HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Amino-4-hydroxybenzoic acid hydrochloride
CAS:<p>3-Amino-4-hydroxybenzoic acid hydrochloride</p>Purity:≥95%Molecular weight:189.60g/mol3-Amino-4-hydroxybenzoic acid hydrochloride
CAS:<p>3-Amino-4-hydroxybenzoic acid hydrochloride (3ABA) is a crystalline compound with a molecular formula of C6H5NO2. It is an acidic compound that is soluble in water and alcohol, but not in ether. 3ABA has been used as the starting material for the synthesis of many other organic compounds. It can be obtained by reacting phenol with chlorobenzoyl chloride to form the chlorobenzoate salt, which on hydrolysis yields 3ABA. This compound has also been used as a reagent for synthesizing carbon nanotubes. The crystal structure of 3ABA was determined using X-ray diffraction data from crystallographic studies, and it was found to have three independent molecules per unit cell. Diffraction indicated that each molecule is composed of two benzene rings joined by a single bond between carbon atoms 1 and 2 and another bond between carbon atoms 2 and 3.</p>Formula:C7H8ClNO3Purity:Min. 95%Molecular weight:189.6 g/mol
