CymitQuimica logo

CAS 157135-53-0

:

N-((tert-butoxycarbonyl)alanyl-prolyl-phenylalanyl)-O-benzoylhydroxylamine

Description:
N-((tert-butoxycarbonyl)alanyl-prolyl-phenylalanyl)-O-benzoylhydroxylamine is a synthetic compound that belongs to the class of peptide derivatives. It features a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect amino groups during chemical reactions. The compound contains a sequence of amino acids, specifically alanine, proline, and phenylalanine, which contribute to its structural and functional properties. The presence of the O-benzoylhydroxylamine moiety suggests potential applications in medicinal chemistry, particularly in the development of prodrugs or as intermediates in the synthesis of more complex molecules. This compound may exhibit specific biological activities due to its peptide structure, which can influence interactions with biological targets. Its stability, solubility, and reactivity are influenced by the functional groups present, making it a subject of interest in both pharmaceutical research and peptide chemistry. As with many synthetic compounds, safety and handling precautions should be observed, and its properties should be characterized through appropriate analytical techniques.
Formula:C29H36N4O7
InChI:InChI=1/C29H36N4O7/c1-19(30-28(38)39-29(2,3)4)26(36)33-17-11-16-23(33)25(35)31-24(34)22(18-20-12-7-5-8-13-20)32-40-27(37)21-14-9-6-10-15-21/h5-10,12-15,19,22-23,32H,11,16-18H2,1-4H3,(H,30,38)(H,31,34,35)/t19-,22-,23-/m0/s1
SMILES:C[C@@H](C(=O)N1CCC[C@H]1C(=O)N=C([C@H](Cc1ccccc1)NOC(=O)c1ccccc1)O)N=C(O)OC(C)(C)C
Synonyms:
  • Boc-ala-pro-phe-HO-Bz
  • N-(tert-butoxycarbonyl)-L-alanyl-N-[(2S)-3-phenyl-2-{[(phenylcarbonyl)oxy]amino}propanoyl]-L-prolinamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.