CAS 157141-27-0
:Cyanomethylenetributylphosphorane
Description:
Cyanomethylenetributylphosphorane, identified by its CAS number 157141-27-0, is a chemical compound that features a phosphorane structure, characterized by a phosphorus atom bonded to three butyl groups and a cyanomethylene group. This compound is notable for its potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds and as a reagent in various chemical reactions. The presence of the cyanomethylene group imparts unique reactivity, allowing it to participate in nucleophilic addition reactions. Additionally, the butyl groups contribute to the lipophilicity of the molecule, influencing its solubility and interaction with other organic compounds. The stability and reactivity of cyanomethylenetributylphosphorane can be affected by factors such as temperature and solvent choice. As with many phosphoranes, it is essential to handle this compound with care due to potential reactivity and toxicity associated with phosphorus-containing compounds. Overall, cyanomethylenetributylphosphorane represents an interesting class of organophosphorus compounds with valuable applications in synthetic chemistry.
Formula:C14H28NP
InChI:InChI=1/C14H28NP/c1-4-7-11-16(14-10-15,12-8-5-2)13-9-6-3/h14H,4-9,11-13H2,1-3H3
SMILES:CCCCP(=CC#N)(CCCC)CCCC
Synonyms:- Cyanomethylenetri-n-butylphosphorane
- (Tributyl-Lambda~5~-Phosphanylidene)Acetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Acetonitrile, 2-(tributylphosphoranylidene)-
CAS:Formula:C14H28NPPurity:95%Color and Shape:LiquidMolecular weight:241.3526Ref: IN-DA001P8O
1g25.00€5g56.00€10g65.00€25g115.00€50g158.00€100g303.00€250gTo inquire500gTo inquire250mg25.00€{[Tri(but-1-yl)]phosphoranylidene}acetonitrile
CAS:{[Tri(but-1-yl)]phosphoranylidene}acetonitrileFormula:C14H28NPPurity:98%Color and Shape: clear. very dark brown/black liquidMolecular weight:241.35g/molCyanomethylenetributylphosphorane
CAS:Formula:C14H28NPPurity:>97.0%(T)Color and Shape:Yellow to Amber to Dark purple clear liquidMolecular weight:241.36Cyanomethylenetributylphosphorane
CAS:Formula:C14H28NPPurity:95%Color and Shape:Liquid, ClearMolecular weight:241.359Cyanomethylenetributylphosphorane
CAS:<p>Cyanomethylenetributylphosphorane (CMTP) is an agent used for the diagnosis of body formation. It is a chemical compound that can be used to produce images of tissue and organs by detecting apoptosis, or programmed cell death. CMTP binds to the glucose-dependent insulinotropic polypeptide receptor (GIPR), stimulating the release of insulin in the pancreas. CMTP also has therapeutic potential for metabolic disorders, as it has been shown to reduce triglycerides and increase HDL cholesterol levels in human serum. CMTP is synthesized from trifluoroacetic acid, which is then reacted with a cyclic peptide containing an amino acid derivative and 1-methyl-2-pyrrolidinone. This reaction produces a molecule with one free amino group at one end and two free carboxylic acid groups at the other end. The molecule can be reacted with epidermal growth factor (EGF) or insulin to</p>Formula:C14H28NPPurity:Min. 95%Color and Shape:Yellow To Dark Brown Clear LiquidMolecular weight:241.35 g/mol




