CAS 15717-17-6
:2-Chlorothiobenzamide
Description:
2-Chlorothiobenzamide is an organic compound characterized by the presence of a thiobenzamide functional group, where a chlorine atom is substituted at the second position of the benzene ring. Its molecular structure includes a benzene ring attached to a thiocarbonyl group (C=S) and an amide group (C=O and NH2). This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the chlorine atom can influence its reactivity and solubility, making it a subject of interest in synthetic chemistry. 2-Chlorothiobenzamide may exhibit properties such as moderate to low solubility in water, but better solubility in organic solvents, which is common for many aromatic compounds. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H6ClNS
InChI:InChI=1/C7H6ClNS/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10)
SMILES:c1ccc(c(c1)C(=N)S)Cl
Synonyms:- Benzenecarbothioamide, 2-chloro-
- 2-Chlorobenzenecarbothioamide
- o-Chlorothiobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chlorothiobenzamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6ClNSPurity:97%Color and Shape:Yellow or pale cream to cream, Crystals or powder or crystalline powderMolecular weight:171.642-Chlorothiobenzamide
CAS:2-ChlorothiobenzamidePurity:≥95%Color and Shape:SolidMolecular weight:171.65g/mol



