CAS 15719-56-9
:1-Heptynyltrimethylsilane
Description:
1-Heptynyltrimethylsilane is an organosilicon compound characterized by the presence of a heptyne functional group, which is an alkyne with a seven-carbon chain, and a trimethylsilyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the terminal alkyne functionality. It is often used as a reagent in organic synthesis, particularly in the formation of carbon-carbon bonds and in the preparation of various silane derivatives. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various chemical reactions, including cross-coupling reactions and as a protecting group for alcohols and amines. Additionally, 1-heptynyltrimethylsilane can participate in hydrosilylation reactions, contributing to the development of more complex silane-based materials. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C10H20Si
InChI:InChI=1/C10H20Si/c1-5-6-7-8-9-10-11(2,3)4/h5-8H2,1-4H3
SMILES:CCCCCC#C[Si](C)(C)C
Synonyms:- Heptynyltrimethylsilane
- Hept-1-Yn-1-Yl(Trimethyl)Silane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Heptynyltrimethylsilane
CAS:S09310 - 1-Heptynyltrimethylsilane
Formula:C10H20SiColor and Shape:LiquidMolecular weight:168.355
