CAS 157199-63-8
:4-[3-(3-Methyl-2(3H)-benzothiazolylidene)-1-propen-1-yl]-1-[3-(trimethylammonio)propyl]quinolinium iodide (1:2)
Description:
4-[3-(3-Methyl-2(3H)-benzothiazolylidene)-1-propen-1-yl]-1-[3-(trimethylammonio)propyl]quinolinium iodide (1:2), with CAS number 157199-63-8, is a synthetic organic compound characterized by its complex structure, which includes a quinolinium core and a benzothiazole moiety. This compound features a positively charged trimethylammonium group, contributing to its solubility in polar solvents and potential applications in biological systems. The presence of the benzothiazole group suggests potential fluorescence properties, making it of interest in photonic applications or as a fluorescent probe. Additionally, the iodide counterion may influence its solubility and stability in various environments. The compound's unique structural features may also impart specific biological activities, making it a candidate for research in medicinal chemistry. Overall, its properties are influenced by the interplay of its functional groups, which can affect its reactivity, solubility, and potential applications in various fields, including materials science and biochemistry.
Formula:C26H31N3S·2I
InChI:InChI=1S/C26H31N3S.2HI/c1-27-24-14-7-8-15-25(24)30-26(27)16-9-11-21-17-19-28(18-10-20-29(2,3)4)23-13-6-5-12-22(21)23;;/h5-9,11-17,19H,10,18,20H2,1-4H3;2*1H/q+2;;/p-2
InChI key:InChIKey=QHNORJFCVHUPNH-UHFFFAOYSA-L
SMILES:C(=CC=C1N(C)C=2C(S1)=CC=CC2)C=3C4=C([N+](CCC[N+](C)(C)C)=CC3)C=CC=C4.[I-]
Synonyms:- 4-[(1E,3E)-3-(3-methyl-1,3-benzothiazol-2(3H)-ylidene)prop-1-en-1-yl]-1-[3-(trimethylammonio)propyl]quinolinium diiodide
- 4-[3-(3-Methyl-2(3H)-benzothiazolylidene)-1-propen-1-yl]-1-[3-(trimethylammonio)propyl]quinolinium iodide (1:2)
- Quinolinium, 4-[3-(3-Methyl-2(3H)-Benzothiazolylidene)-1-Propenyl]-1-[3-(Trimethylammonio)Propyl]-, Diiodide
- Quinolinium, 4-[3-(3-methyl-2(3H)-benzothiazolylidene)-1-propen-1-yl]-1-[3-(trimethylammonio)propyl]-, iodide (1:2)
- TO-PRO 3 iodide
- To-Pro 3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
TO-PRO3 iodide
CAS:<p>TO-PRO3 iodide is a nucleic acid stain that can stain the nucleus of cells in different states, including living, early apoptotic, and necrotic cells.</p>Formula:C26H31I2N3SColor and Shape:SolidMolecular weight:671.42
