CAS 1572-13-0
:1H-Pyrazole-4-carboxylic acid, 3,5-diamino-, methyl ester
Description:
1H-Pyrazole-4-carboxylic acid, 3,5-diamino-, methyl ester, with the CAS number 1572-13-0, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and two amino groups at the 3 and 5 positions of the pyrazole ring, contributing to its potential as a versatile building block in organic synthesis. The methyl ester group enhances its solubility in organic solvents and may influence its reactivity. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and agrochemicals. The presence of multiple functional groups allows for various chemical transformations, which can be exploited in synthetic pathways. Additionally, the compound's stability, melting point, and solubility characteristics can vary based on environmental conditions and the presence of other reagents. Overall, this compound serves as a significant intermediate in the development of pharmaceuticals and other chemical applications.
Formula:C5H8N4O2
InChI:InChI=1S/C5H8N4O2/c1-11-5(10)2-3(6)8-9-4(2)7/h1H3,(H5,6,7,8,9)
InChI key:InChIKey=DBRGFYZSJHOBGU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(N)=NNC1N
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3,5-diamino-, methyl ester
- NSC 625015
- Pyrazole-4-carboxylic acid, 3,5-diamino-, methyl ester
- Methyl 3,5-diamino-1H-pyrazole-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3,5-diamino-1H-pyrazole-4-carboxylate
CAS:Formula:C5H8N4O2Color and Shape:SolidMolecular weight:156.1426Methyl 3,5-diamino-1H-pyrazole-4-carboxylate
CAS:<p>Methyl 3,5-diamino-1H-pyrazole-4-carboxylate is a chemical compound with the molecular formula CH3N2C(NH2)C(=O)OCH3. It is a condensation product of acetoacetic ester and x-ray structural analysis. The structural analysis of methyl 3,5-diamino-1H-pyrazole-4-carboxylate has shown that it is a 1:1 mixture of the two stereoisomers at the central carbon atom. The acetoacetic ester moiety of methyl 3,5-diamino-1H-pyrazole-4-carboxylate has been shown to have protective effects against acetaminophen (paracetamol)-induced hepatotoxicity in mice. Methyl 3,5 -diamino -1H -pyrazole -4 carboxylate is an intermediate in the</p>Formula:C5H8N4O2Purity:Min. 95%Molecular weight:156.14 g/mol

