CymitQuimica logo

CAS 157283-72-2

:

Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-15-methyl-, 1-methylethyl ester, (5Z,9α,11α,13E,15S)-

Description:
Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-15-methyl-, 1-methylethyl ester, with the CAS number 157283-72-2, is a synthetic derivative of prostaglandins, which are bioactive lipids involved in various physiological processes. This compound features multiple hydroxyl groups, contributing to its hydrophilicity and potential interactions with biological systems. The presence of a methyl group and an isopropyl ester enhances its lipophilicity, which may influence its absorption and distribution in biological tissues. The specific stereochemistry indicated by the nomenclature suggests that it has defined spatial arrangements that are crucial for its biological activity. This compound may exhibit anti-inflammatory properties and could be involved in modulating pain and other physiological responses. Its structural characteristics allow it to interact with specific receptors, potentially leading to therapeutic applications. However, detailed studies on its pharmacokinetics, efficacy, and safety profile are essential for understanding its full potential in clinical settings.
Formula:C24H42O5
InChI:InChI=1S/C24H42O5/c1-5-6-11-15-24(4,28)16-14-20-19(21(25)17-22(20)26)12-9-7-8-10-13-23(27)29-18(2)3/h7,9,14,16,18-22,25-26,28H,5-6,8,10-13,15,17H2,1-4H3/b9-7-,16-14+/t19-,20-,21+,22-,24+/m1/s1
InChI key:InChIKey=DMLOOJUPVUOLJU-JPXDXFKVSA-N
SMILES:C(=C/[C@@](CCCCC)(C)O)\[C@@H]1[C@@H](C/C=C\CCCC(OC(C)C)=O)[C@@H](O)C[C@H]1O
Synonyms:
  • Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-15-methyl-, 1-methylethyl ester, (5Z,9α,11α,13E,15S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.