
CAS 15729-76-7
:2,5-Diethylthiazole
Description:
2,5-Diethylthiazole is a heterocyclic organic compound characterized by a five-membered ring containing both sulfur and nitrogen atoms. It features two ethyl groups attached to the 2 and 5 positions of the thiazole ring, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. 2,5-Diethylthiazole is known for its applications in the synthesis of various organic compounds and may serve as an intermediate in the production of agrochemicals and pharmaceuticals. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Safety data indicates that, like many thiazole derivatives, it should be handled with care due to potential irritant properties. Overall, 2,5-Diethylthiazole is a valuable compound in organic chemistry with diverse applications.
Formula:C7H11NS
InChI:InChI=1S/C7H11NS/c1-3-6-5-8-7(4-2)9-6/h5H,3-4H2,1-2H3
InChI key:InChIKey=PATFUZGQWONVOC-UHFFFAOYSA-N
SMILES:C(C)C=1SC(CC)=NC1
Synonyms:- 2,5-Diethyl-1,3-thiazole
- Thiazole, 2,5-diethyl-
- 2,5-Diethylthiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
