CAS 1573-91-7

4-hydroxynaphthalene-2-carboxylic acid

Description:

4-Hydroxynaphthalene-2-carboxylic acid, also known as 2-Carboxy-4-hydroxynaphthalene, is an organic compound characterized by its naphthalene backbone with hydroxyl and carboxylic acid functional groups. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl and carboxylic acid groups. It exhibits properties such as being a weak acid, capable of donating protons in solution. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in dye production, pharmaceuticals, and as a building block for more complex chemical structures. Additionally, it may exhibit biological activity, making it a subject of research in medicinal chemistry. Its molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in the development of derivatives with tailored properties. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₈O₃

InChI: InChI=1/C11H8O3/c12-10-6-8(11(13)14)5-7-3-1-2-4-9(7)10/h1-6,12H,(H,13,14)

SMILES: c1ccc2c(c1)cc(cc2O)C(=O)O

Synonyms:

• 1,2-Hydroxy-3-naphthoic acid
• 4-Hydroxy-2-Naphthoic Acid

2-Naphthalenecarboxylic acid, 4-hydroxy-

CAS: 1573-91-7

Formula: C₁₁H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.1794

Ref: IN-DA00ABHE

4-Hydroxy-2-naphthoic acid

CAS: 1573-91-7

4-Hydroxy-2-naphthoic acid

Purity: 99%

Molecular weight: 188.18g/mol

Ref: 54-OR510222

4-HYDROXY-2-NAPHTHOIC ACID

CAS: 1573-91-7

Formula: C₁₁H₈O₃

Purity: 95%

Molecular weight: 188.182

Ref: 10-F528946

4-Hydroxy-2-naphthoic acid

CAS: 1573-91-7

4-Hydroxy-2-naphthoic acid is a hydrocarbon with a carboxylic acid group. It can act as an antagonist to the hydrocarbon receptor (HCR). 4-Hydroxy-2-naphthoic acid has been shown to be effective in treating colon cancer cells in vitro, and has been shown to inhibit the growth of cancer cells in vivo. This compound is also effective at inhibiting the proliferation of human colon cancer cells (Caco2) that have been exposed to benzo(a)pyrene, an aromatic hydrocarbon found in cigarette smoke. The mechanism by which this drug inhibits cell proliferation is not fully understood but may involve inhibition of cytochrome P450 1A1 (CYP1A1), which metabolizes benzo(a)pyrene into carcinogenic intermediates. 4-Hydroxy-2-naphthoic acid has also been shown to be anisotropic and microreactor, meaning

Formula: C₁₁H₈O₃

Purity: Min. 95%

Molecular weight: 188.17 g/mol

Ref: 3D-BAA57391