CAS 15733-85-4
:8-Nitro-2-quinolinecarboxylic acid
Description:
8-Nitro-2-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which features a nitrogen-containing bicyclic aromatic system. The presence of a nitro group at the 8-position and a carboxylic acid group at the 2-position contributes to its unique chemical properties. This compound is typically a yellow crystalline solid and is soluble in polar organic solvents. It exhibits acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The nitro group can also serve as a site for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, 8-nitro-2-quinolinecarboxylic acid may exhibit biological activity, which has drawn interest in medicinal chemistry and pharmacology. Its potential applications include use as a building block in the synthesis of more complex molecules or as a probe in biochemical studies. Overall, this compound's structural features and functional groups make it significant in both synthetic and applied chemistry contexts.
Formula:C10H6N2O4
InChI:InChI=1S/C10H6N2O4/c13-10(14)7-5-4-6-2-1-3-8(12(15)16)9(6)11-7/h1-5H,(H,13,14)
InChI key:InChIKey=YKNRUBPOGQLIKS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C=CC(C(O)=O)=N2)C=CC1
Synonyms:- 2-Carboxy-8-nitroquinoline
- Quinaldic acid, 8-nitro-
- 8-Nitro-2-quinolinecarboxylic acid
- 2-Quinolinecarboxylic acid, 8-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
8-Nitroquinoline-2-carboxylic acid
CAS:8-Nitroquinoline-2-carboxylic acid is a spectrometric, inorganic compound that is structurally modified to have an electron-donating group. Modifications on the nitrogen atoms of 8-Nitroquinoline-2-carboxylic acid allow for long-term treatment. It is also used as a fluorophore and has shown to interact with metal ions and form an inorganic complex. 8-Nitroquinoline-2-carboxylic acid can be used for the detection of metal ions by mass spectrometry and microscopy. This compound has been shown to be effective in preventing nitrosamine formation and in the prevention of cancer cells from proliferating.Formula:C10H6N2O4Purity:Min. 95%Molecular weight:218.17 g/mol
