CAS 15733-89-8: 2-Hydroxycinchoninic acid
Description:2-Hydroxycinchoninic acid is an organic compound that belongs to the class of cinchona alkaloids, characterized by its hydroxyl and carboxylic acid functional groups. It is a white to off-white crystalline solid that is soluble in water and organic solvents, reflecting its polar nature due to the presence of the hydroxyl group. This compound exhibits interesting chemical properties, including the ability to form salts and esters, which can be utilized in various chemical reactions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in analytical chemistry as a chiral auxiliary. The compound's structure allows it to participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, 2-hydroxycinchoninic acid may exhibit biological activity, making it a subject of interest in research related to drug development and synthesis. Its CAS number, 15733-89-8, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14)
InChI key:InChIKey=MFSHNFBQNVGXJX-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC(=O)NC=2C=CC=CC21
- Synonyms:
- 1,2-Dihydro-2-oxo-4-quinolinecarboxylic acid
- 2-Hydroxy-4-Quinolincarboxylic Acid
- 2-Hydroxy-4-carboxyquinoline
- 2-Hydroxy-4-quinolinecarboxylic acid
- 2-Hydroxycinchoninic acid
- 2-Oxo-1,2-Dihydroquinoline-4-Carboxylate
- 2-Oxo-1,2-dihydroquinoline-4-carboxylic acid
- 2-Oxo-1H-quinoline-4-carboxylic acid
- 4-Carboxycarbostyril
- 4-Quinolinecarboxylic acid, 1,2-dihydro-2-oxo-
- See more synonyms
- Cinchoninic acid, 2-hydroxy-
- NSC 3564
