CymitQuimica logo

CAS 157335-97-2

:

5-bromo-4,6-dimethyl-pyrimidine

Description:
5-Bromo-4,6-dimethyl-pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with bromine and methyl groups. The presence of the bromine atom at the 5-position and two methyl groups at the 4 and 6 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. It is often used in organic synthesis and pharmaceutical research due to its potential as an intermediate in the production of various bioactive compounds. The bromine substituent can participate in nucleophilic substitution reactions, making it a versatile building block in synthetic chemistry. Additionally, the methyl groups can influence the compound's reactivity and stability, affecting its interactions with other chemical species. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling measures should be observed in laboratory settings. Overall, 5-bromo-4,6-dimethyl-pyrimidine is an important compound in the field of medicinal chemistry and organic synthesis.
Formula:C6H7BrN2
InChI:InChI=1/C6H7BrN2/c1-4-6(7)5(2)9-3-8-4/h3H,1-2H3
InChI key:WDMWXYZJJVYMHE-UHFFFAOYSA-N
SMILES:Cc1c(c(C)ncn1)Br
Synonyms:
  • 5-Bromo-4,6-Dimethylpyrimidine
  • Pyrimidine, 5-Bromo-4,6-Dimethyl-
Found 4 products.