CAS 1573548-32-9

4-(Acetylamino)-1H-indole-1-acetic acid

Description:

4-(Acetylamino)-1H-indole-1-acetic acid, identified by its CAS number 1573548-32-9, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance contains an acetylamino group and an acetic acid moiety, contributing to its potential biological activity. The presence of the acetylamino group suggests that it may participate in various biochemical interactions, possibly influencing enzyme activity or receptor binding. The indole framework is known for its role in many natural products and pharmaceuticals, often exhibiting properties such as anti-inflammatory, analgesic, and antimicrobial activities. The carboxylic acid functionality in the acetic acid part may enhance its solubility in polar solvents and facilitate interactions with biological systems. Overall, this compound's unique structure may render it of interest in medicinal chemistry and drug development, although specific applications and biological effects would require further investigation through empirical studies.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1S/C12H12N2O3/c1-8(15)13-10-3-2-4-11-9(10)5-6-14(11)7-12(16)17/h2-6H,7H2,1H3,(H,13,15)(H,16,17)

InChI key: InChIKey=VPHYPSQYMVEFCA-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=2C(=C(NC(C)=O)C=CC2)C=C1

Synonyms:

• 4-(Acetylamino)-1H-indole-1-acetic acid
• 1H-Indole-1-acetic acid, 4-(acetylamino)-

2-(4-Acetamido-1H-indol-1-yl)acetic acid

CAS: 1573548-32-9

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 232.23 g/mol

Ref: 3D-YMC54832