CAS 157360-93-5

Propanimidamide, 3-methoxy-, hydrochloride (1:1)

Description:

Propanimidamide, 3-methoxy-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and methoxy substitution. It typically appears as a white to off-white crystalline solid, which is soluble in water due to the presence of the hydrochloride salt form. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the methoxy group can influence its lipophilicity and overall reactivity, making it an interesting candidate for further research. As with many amides, it may participate in hydrogen bonding, affecting its interactions with biological targets. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, Propanimidamide, 3-methoxy-, hydrochloride (1:1) represents a class of compounds that can be valuable in various chemical and pharmaceutical applications.

Formula: C₄H₁₀N₂O·ClH

InChI: InChI=1S/C4H10N2O.ClH/c1-7-3-2-4(5)6;/h2-3H2,1H3,(H3,5,6);1H

InChI key: InChIKey=KRGDUBQLCSQJJK-UHFFFAOYSA-N

SMILES: C(C(=N)N)COC.Cl

Synonyms:

• 3-Methoxypropanamidine hydrochloride
• Propanimidamide, 3-methoxy-, monohydrochloride
• Propanimidamide, 3-methoxy-, hydrochloride (1:1)
• 3-Methoxypropanimidamide hydrochloride

3-Methoxypropanimidamide hydrochloride

CAS: 157360-93-5

Versatile small molecule scaffold

Formula: C₄H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 138.59 g/mol

Ref: 3D-HGA36093