CAS 157373-08-5

2,3,4-trifluorobenzoyl chloride

Description:

2,3,4-Trifluorobenzoyl chloride is an aromatic acyl chloride characterized by the presence of three fluorine atoms positioned at the 2, 3, and 4 positions on a benzene ring, along with a carbonyl group (C=O) and a chlorine atom (Cl) attached to the benzene. This compound is typically a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. It is known for its role as an acylating agent in organic synthesis, particularly in the formation of various derivatives through acylation reactions. The presence of fluorine atoms enhances its electrophilicity, making it more reactive compared to non-fluorinated analogs. Additionally, 2,3,4-trifluorobenzoyl chloride is sensitive to moisture and can hydrolyze to form the corresponding carboxylic acid and hydrochloric acid. Safety precautions are essential when handling this compound due to its corrosive nature and potential to cause severe irritation to skin and eyes. Proper storage in a cool, dry place, away from moisture, is recommended to maintain its stability.

Formula: C₇H₂ClF₃O

InChI: InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H

SMILES: c1cc(c(c(c1C(=O)Cl)F)F)F

2,3,4-Trifluorobenzoyl Chloride

CAS: 157373-08-5

Formula: C₇H₂ClF₃O

Purity: >98.0%(T)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 194.54

Ref: 3B-T1868

Benzoyl chloride, 2,3,4-trifluoro-

CAS: 157373-08-5

Formula: C₇H₂ClF₃O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 194.5384

Ref: IN-DA001PEW

2,3,4-Trifluorobenzoyl chloride

CAS: 157373-08-5

2,3,4-Trifluorobenzoyl chloride

Formula: C₇H₂ClF₃O

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 194.54g/mol

Ref: 54-PC7285

2,3,4-Trifluorobenzoyl chloride

CAS: 157373-08-5

Formula: C₇H₂ClF₃O

Purity: 98%

Color and Shape: Liquid, Clear

Molecular weight: 194.54

Ref: 10-F007494

2,3,4-Trifluorobenzoyl Chloride

Controlled Product

CAS: 157373-08-5

Applications Reagent used in the preparation of Levofloxacin.
References Sidique, S., et al.: Bioorg. Med. Chem. Lett., 19, 5773 (2009),

Formula: C₇H₂ClF₃O

Color and Shape: Neat

Molecular weight: 194.54

Ref: TR-T790075