CAS 157381-54-9
:RPI 856 A
Description:
RPI 856 A, with the CAS number 157381-54-9, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is known for its role as a selective inhibitor of certain biological pathways, which may contribute to its efficacy in treating specific diseases. The compound exhibits a unique structure that allows it to interact with target proteins or enzymes, influencing various biochemical processes. Its solubility, stability, and bioavailability are critical characteristics that determine its suitability for pharmaceutical development. Additionally, RPI 856 A has undergone various studies to assess its pharmacokinetics and pharmacodynamics, providing insights into its mechanism of action and potential side effects. As research continues, the compound's profile may reveal further applications and enhance our understanding of its role in therapeutic contexts.
Formula:C43H61N7O13
InChI:InChI=1/C43H61N7O13/c1-20(2)14-29(46-41(60)35(50-38(57)32(44)21(3)4)25-16-26(51)18-27(52)17-25)37(56)45-28(15-24-12-10-9-11-13-24)36(55)42(61)49-34(23(7)8)40(59)48-33(22(5)6)39(58)47-30(43(62)63)19-31(53)54/h9-13,16-18,20-23,28-30,32-35,51-52H,14-15,19,44H2,1-8H3,(H,45,56)(H,46,60)(H,47,58)(H,48,59)(H,49,61)(H,50,57)(H,53,54)(H,62,63)/t28-,29+,30+,32+,33+,34+,35?/m1/s1
Synonyms:- N-[3-({N-[(3,5-dihydroxyphenyl)(valylamino)acetyl]leucyl}amino)-2-oxo-4-phenylbutanoyl]valylvalylaspartic acid
- L-Aspartic acid, L-valyl-2-(3,5-dihydroxyphenyl)glycyl-L-leucyl-2-oxo-4-phenyl-3-aminobutanoyl-L-valyl-L-valyl-
- Rpi 856 A
- Valyl-adpaa-leucyl-aopba-valyl-valyl-aspartic acid
- N-[(3S)-3-({N-[(3,5-dihydroxyphenyl)(L-valylamino)acetyl]-L-leucyl}amino)-2-oxo-4-phenylbutanoyl]-L-valyl-L-valyl-L-aspartic acid
- N-[(3R)-3-({N-[(3,5-dihydroxyphenyl)(L-valylamino)acetyl]-L-leucyl}amino)-2-oxo-4-phenylbutanoyl]-L-valyl-L-valyl-L-aspartic acid
- Rpi 856 B
- Rpi-856 A
- Val-adpaa-leu-aopba-val-val-asp
- Valyl-(2-amino-2-(3,5-dihydroxyphenyl)acetic acid)-leucyl-(3-amino-2-oxo-4-phenylbutyric acid)-valyl-valyl-aspartic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Rpi 856 A
CAS:Rpi 856 A is a retrovirus protease inhibitor. It is effective against HIV-1 and HTLV-1 proteases.Formula:C43H61N7O13Purity:98%Color and Shape:SolidMolecular weight:883.997
