CAS 157415-17-3
:Morpholinoformamidine hydrobromide
Description:
Morpholinoformamidine hydrobromide is a chemical compound characterized by its unique structure, which includes a morpholino group and a formamidine moiety. It is typically encountered as a hydrobromide salt, enhancing its solubility in polar solvents. This compound is often utilized in biochemical research, particularly in the development of pharmaceuticals and as a reagent in organic synthesis. Morpholinoformamidine hydrobromide exhibits properties that make it suitable for various applications, including its ability to act as a building block in the synthesis of more complex molecules. Additionally, it may possess biological activity, which is of interest in medicinal chemistry. The compound is generally handled with care, as with many chemical substances, due to potential toxicity and the need for proper safety protocols during its use. Its stability, solubility, and reactivity can vary depending on the conditions, making it essential to consider these factors in experimental designs. Overall, Morpholinoformamidine hydrobromide is a valuable compound in the field of chemical research and development.
Formula:C5H12BrN3O
InChI:InChI=1/C5H11N3O.BrH/c6-5(7)8-1-3-9-4-2-8;/h1-4H2,(H3,6,7);1H
SMILES:C1COCCN1C(=N)N.Br
Synonyms:- Morpholine-4-Carboximidamide
- Morpholine-4-Carboximidamide Hydrobromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Morpholine-4-carboxamidine hydrobromide, 98%
CAS:<p>It is used as an active pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not ch</p>Formula:C5H12BrN3OPurity:98%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:210.084-Morpholinecarboximidamide, hydrobromide (1:1)
CAS:Formula:C5H12BrN3OPurity:95%Color and Shape:SolidMolecular weight:210.0723Morpholinoformamidine hydrobromide
CAS:Morpholinoformamidine hydrobromidePurity:98%Molecular weight:210.07g/molMorpholine-4-carboximidamide hydrobromide
CAS:Formula:C5H12BrN3OPurity:95%Color and Shape:SolidMolecular weight:210.075



