CAS 157488-65-8: (R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)dimethylamine
Description:(R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a:3,4-a']dinaphthalen-4-yl)dimethylamine, with CAS number 157488-65-8, is a complex organic compound characterized by its unique bicyclic structure that incorporates both phosphorus and oxygen atoms within its framework. This compound features a phosphine oxide moiety, which contributes to its potential reactivity and interaction with other chemical species. The presence of dimethylamine suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The stereochemistry indicated by the (R)-(-) designation implies that the compound has a specific three-dimensional arrangement, which can influence its biological activity and interactions. Additionally, the presence of multiple aromatic rings may enhance its stability and solubility in organic solvents. Overall, this compound's distinctive structural features make it of interest in fields such as medicinal chemistry, materials science, and catalysis, where its unique properties can be exploited for various applications.
Formula:C22H18NO2P
InChI:InChI=1/C22H18NO2P/c1-23(2)26-24-19-13-11-15-7-3-5-9-17(15)21(19)22-18-10-6-4-8-16(18)12-14-20(22)25-26/h3-14H,1-2H3
- Synonyms:
- (R)-(-)-[4-N,N-Dimethylamino]dinaphtho[2.1-d:1'.2'-f][1.3.2]dioxaphosphepine
- (R)-monophos
- (R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a3,4-a']dinaphthalen-4-yl)dimethylamine
- (R)-(-)-4-(N,N-Dimethylamino)-dinaphtho[2,1-d:1',2'-f]-1,3,2-dioxaphosphepin

(R)-(-)-(3,5-Dioxa-4-phosphacyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)dimethylamine
Ref: 3B-D4992
1g | 73.00 € | ||
5g | 266.00 € |

(R)-(-)-(3,5-Dioxa-4-phospha-cyclohepta[2,1-a;3,4-a']dinaphthalen-4-yl)dimethylamine, min. 97% (R)-MONOPHOS
Ref: 08-15-1232
1g | 100.00 € | ||
250mg | 37.00 € |

Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin-4-amine, N,N-dimethyl-, (11bR)-
Ref: IN-DA001PGY
1g | 26.00 € | ||
5g | 68.00 € | ||
10g | 125.00 € | ||
25g | 168.00 € | ||
250mg | 21.00 € |

(R)-(?)-(3,5-Dioxa-4-Phosphacyclohepta[2,1-a:3,4-a]Dinaphthalen-4-Yl)Dimethylamine
Ref: 54-OR1008390
1g | 36.00 € | ||
5g | 61.00 € | ||
25g | 220.00 € | ||
100g | 788.00 € | ||
500g | 3,536.00 € | ||
250mg | 32.00 € |

(R)-Monophos
Ref: 3D-FM180381
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information |