CAS 1575-47-9
:4-phenylfuran-2(5H)-one
Description:
4-Phenylfuran-2(5H)-one, also known as coumarin-4-phenyl, is an organic compound characterized by its fused furan and phenyl rings. It features a lactone structure, which contributes to its aromatic properties. This compound typically appears as a pale yellow to white crystalline solid and is known for its pleasant, sweet odor, reminiscent of vanilla, making it of interest in the fragrance and flavor industries. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. The compound exhibits various biological activities, including potential antioxidant and antimicrobial properties, which have been the subject of research in pharmacology. Its chemical structure allows for various substitutions, leading to derivatives with altered properties and activities. As with many organic compounds, safety precautions should be taken when handling 4-phenylfuran-2(5H)-one, as it may pose health risks if ingested or inhaled. Overall, this compound is significant in both synthetic organic chemistry and potential applications in medicinal chemistry.
Formula:C10H8O2
InChI:InChI=1/C10H8O2/c11-10-6-9(7-12-10)8-4-2-1-3-5-8/h1-6H,7H2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Phenyl-2,5-dihydrofuran-2-one
CAS:4-Phenyl-2,5-dihydrofuran-2-one is a natural product that can be found in the plant Stenotrophomonas maltophilia. It is a cyclic compound and has been shown to have labeling functions. 4-Phenyl-2,5-dihydrofuran-2-one also plays a role in cellular motility and is involved in the biosynthesis of cyclic lipopeptides. This compound has been shown to activate the host plant's defense system against pathogens and pests. 4-Phenyl-2,5-dihydrofuran-2-one is synthesized through fatty acid synthesis, which produces fatty acids. These fatty acids are then broken down into two molecules of acetate and one molecule of CO2 through beta oxidation.Formula:C10H8O2Purity:Min. 95%Molecular weight:160.17 g/mol

