CAS 15750-47-7
:Cerium(III)oxalate hydrate
Description:
Cerium(III) oxalate hydrate is a coordination compound formed from cerium, a rare earth element, and oxalic acid. It typically appears as a crystalline solid, often exhibiting a white to pale yellow color. The compound is characterized by its solubility in acidic solutions, while being relatively insoluble in neutral or basic conditions. Cerium(III) oxalate hydrate is known for its stability under ambient conditions, although it can decompose upon heating, releasing carbon dioxide and other byproducts. The presence of water molecules in its structure contributes to its hydrate classification, affecting its physical properties such as hygroscopicity. This compound is of interest in various applications, including catalysis, materials science, and as a precursor for cerium oxide, which is widely used in polishing and as a catalyst in various chemical reactions. Additionally, cerium compounds have potential applications in the fields of electronics and environmental remediation due to their unique redox properties.
Formula:C2H2CeO5
InChI:InChI=1/C2H2O4.Ce.H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;1H2/q;+3;/p-2
Synonyms:- Ceriumoxalate hydrate
- Cerium iii oxalate, nonahydrate
- Cerium(3+) Ethanedioate (2:3)
- Cerium(3+) Ethanedioate Hydrate (2:3:1)
- Ethanedioate, Cerium(3+) Salt, Monohydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cerium(III) oxalate hydrate, REacton™, 99.9% (REO)
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C6Ce2O12Purity:99.9%Molecular weight:544.29Cerium(III) oxalate hydrate, 99%
CAS:It is used in ceramics, glass, phosphors and pyrotechnics. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has
Formula:C6Ce2O12Purity:99%Molecular weight:544.29
