CAS 1576-45-0
:3-(Phenylsulfamoyl)benzoic acid
Description:
3-(Phenylsulfamoyl)benzoic acid, with the CAS number 1576-45-0, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a phenylsulfamoyl group. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the phenyl group enhances its lipophilicity, potentially influencing its biological activity and solubility properties. Typically, compounds like this exhibit moderate to high melting points and may be soluble in polar organic solvents. The sulfonamide group can impart antibacterial properties, making such compounds of interest in medicinal chemistry. Additionally, the structural arrangement allows for potential interactions with biological targets, which can be explored for therapeutic applications. Overall, 3-(Phenylsulfamoyl)benzoic acid is a compound of interest in both synthetic and medicinal chemistry due to its unique functional groups and potential biological activities.
Formula:C13H11NO4S
InChI:InChI=1S/C13H11NO4S/c15-13(16)10-5-4-8-12(9-10)19(17,18)14-11-6-2-1-3-7-11/h1-9,14H,(H,15,16)
InChI key:InChIKey=YNRKZIPFWSDERE-UHFFFAOYSA-N
SMILES:S(NC1=CC=CC=C1)(=O)(=O)C2=CC(C(O)=O)=CC=C2
Synonyms:- 3-[(Phenylamino)sulfonyl]benzoic acid
- Benzoic acid, 3-[(phenylamino)sulfonyl]-
- 3-(Phenylsulfamoyl)benzoic acid
- Benzoic acid, m-(phenylsulfamoyl)-
- 3-[(Phenylamino)sulfonyl]benzenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3-(Anilinosulfonyl)-benzenecarboxylic Acid -D5
CAS:Controlled ProductApplications 3-(Anilinosulfonyl)-benzenecarboxylic Acid -D5 is the labeled compound of 3-(Anilinosulfonyl)-benzenecarboxylic Acid (3-ASBA) (A157600). 3-(Anilinosulfonyl)-benzenecarboxylic Acid (3-ASBA) is used in preparation of N-hydroxy[(phenylsulfamoyl)phenyl]acrylamides useful as histone deacetylase inhibitors for the treatment of cancer.
References Yihan, W., et al.: Patents, (2017),Formula:C13D5H6NO4SColor and Shape:NeatMolecular weight:282.3273-(Anilinosulfonyl)-benzenecarboxylic Acid (3-ASBA)
CAS:Controlled ProductFormula:C13H11NO4SColor and Shape:NeatMolecular weight:277.296

