
CAS 1576-69-8
:2,7-Dimethylphenanthrene
Description:
2,7-Dimethylphenanthrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its fused ring structure, which consists of three benzene rings. This compound features two methyl groups attached to the phenanthrene backbone at the 2 and 7 positions, influencing its chemical properties and reactivity. It is typically a solid at room temperature and exhibits a high melting point, which is common among PAHs due to their planar structure and strong π-π stacking interactions. 2,7-Dimethylphenanthrene is relatively hydrophobic, making it poorly soluble in water but soluble in organic solvents. It is known for its stability and resistance to degradation, which can lead to environmental persistence. This compound is of interest in various fields, including organic chemistry and environmental science, due to its potential role as a pollutant and its implications in studies related to carcinogenicity. Additionally, it can be used as a reference standard in analytical chemistry for the detection and quantification of PAHs in environmental samples.
Formula:C16H14
InChI:InChI=1S/C16H14/c1-11-3-7-15-13(9-11)5-6-14-10-12(2)4-8-16(14)15/h3-10H,1-2H3
InChI key:InChIKey=BKPXLOGIVVCOHT-UHFFFAOYSA-N
SMILES:CC1=CC=2C(=C3C(=CC2)C=C(C)C=C3)C=C1
Synonyms:- NSC 407670
- 2,7-Dimethylphenanthrene
- Phenanthrene, 2,7-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
