CAS 15760-18-6

3-(4-Methyl-3-cyclohexenyl)butanol

Description:

3-(4-Methyl-3-cyclohexenyl)butanol, with the CAS number 15760-18-6, is an organic compound characterized by its unique structure that includes a cyclohexene ring and a butanol side chain. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The presence of the cyclohexene moiety imparts certain reactivity and stability characteristics, making it a potential candidate for various chemical reactions, including those involving substitution and elimination. The methyl group on the cyclohexene ring enhances its steric properties and can influence its physical characteristics, such as boiling point and solubility. Typically, compounds like this may exhibit moderate polarity due to the hydroxyl group, allowing for hydrogen bonding, which can affect their solubility in polar solvents. Additionally, the compound may have applications in organic synthesis, fragrance formulation, or as an intermediate in the production of other chemical substances. Its specific properties, such as melting point, boiling point, and reactivity, would need to be determined through experimental data.

Formula: C₁₁H₂₀O

InChI: InChI=1S/C11H20O/c1-9-3-5-11(6-4-9)10(2)7-8-12/h3,10-12H,4-8H2,1-2H3

InChI key: InChIKey=JTVKFAPEIBMMHX-UHFFFAOYSA-N

SMILES: C(CCO)(C)C1CCC(C)=CC1

Synonyms:

• Citrus propanol
• γ,4-Dimethyl-3-cyclohexene-1-propanol
• 3-(4-Methylcyclohex-3-enyl)butan-1-ol
• 3-Cyclohexene-1-propanol, γ,4-dimethyl-
• 3-(4-Methyl-3-cyclohexenyl)butanol