CAS 15760-36-8

3-METHYLENECYCLOBUTANECARBOXYLIC ACID

Description:

3-Methylenecyclobutanecarboxylic acid is an organic compound characterized by its unique cyclobutane ring structure, which is substituted with a methylene group and a carboxylic acid functional group. This compound features a four-membered carbon ring, making it a cyclic alkene, and the presence of the carboxylic acid group contributes to its acidity and reactivity. The methylene group introduces additional flexibility and potential for further chemical transformations. Typically, compounds like this may exhibit interesting properties such as being a potential intermediate in organic synthesis or serving as a building block for more complex molecules. Its reactivity can be influenced by the strain in the cyclobutane ring, which can lead to various chemical reactions, including ring-opening or functionalization. Additionally, the compound's physical properties, such as boiling point and solubility, would depend on the specific molecular interactions and the presence of the carboxylic acid group, which can enhance solubility in polar solvents. Overall, 3-methylenecyclobutanecarboxylic acid is a compound of interest in organic chemistry due to its structural features and potential applications.

Formula: C₆H₈O₂

InChI: InChI=1S/C6H8O2/c1-4-2-5(3-4)6(7)8/h5H,1-3H2,(H,7,8)

InChI key: InChIKey=NNKLICLIBKMDOY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(=C)C1

Synonyms:

• 3-(Methylene)cyclobutane-1-carboxylic acid
• 3-Methylene-Cyclobutanecarboxylicaci
• 3-Methylenecyclobutylcarboxylic acid
• 3-Methylidenecyclobutane-1-Carboxylic Acid
• 3-Methylidenecyclobutanecarboxylic Acid
• Cyclobutanecarboxylic acid, 3-Methylene-
• Rarechem Al Bo 0919
• 3-Methylenecyclobutanecarboxylic acid

Cyclobutanecarboxylic acid, 3-methylene-

CAS: 15760-36-8

Formula: C₆H₈O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 112.1265

Ref: IN-DA001PJK

3-Methylenecyclobutane-1-carboxylic acid

CAS: 15760-36-8

3-Methylenecyclobutane-1-carboxylic acid

Formula: C₆H₈O₂

Purity: 97%

Color and Shape: clear. almost colourless liquid

Molecular weight: 112.13g/mol

Ref: 54-OR6346

3-Methylenecyclobutanecarboxylic acid

CAS: 15760-36-8

Formula: C₆H₈O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 112.128

Ref: 10-F047299