CAS 15761-61-2

4-O-β-D-Glucopyranosyl-D-mannose

Description:

4-O-β-D-Glucopyranosyl-D-mannose, with the CAS number 15761-61-2, is a glycoside that features a glucopyranosyl group linked to a D-mannose unit. This compound is characterized by its structural configuration, which includes a β-glycosidic bond between the two sugar moieties. It is soluble in water due to the presence of multiple hydroxyl groups, which enhance its hydrophilicity. The compound is typically found in various natural sources and may play a role in biological processes, such as cell recognition and signaling. Its properties can be influenced by factors such as pH and temperature, which may affect its stability and reactivity. Additionally, 4-O-β-D-Glucopyranosyl-D-mannose can be involved in various biochemical applications, including studies related to carbohydrate chemistry and potential therapeutic uses. Understanding its characteristics is essential for exploring its functionality in both natural and synthetic contexts.

Formula: C₁₂H₂₂O₁₁

InChI: InChI=1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h1,4-12,14-21H,2-3H2/t4-,5-,6-,7-,8-,9+,10-,11-,12+/m1/s1

InChI key: InChIKey=DKXNBNKWCZZMJT-VOXHDCLVSA-N

SMILES: O([C@@H]([C@@H]([C@@H](C=O)O)O)[C@@H](CO)O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O

Synonyms:

• 4-O-β-D-Glucopyranosyl-D-mannose
• D-Mannose, 4-O-β-D-glucopyranosyl-
• Mannose, 4-O-β-D-glucopyranosyl-, D-
• Epimaltose

4-Glucopyranosylmannose

CAS: 15761-61-2

4-Glucopyranosylmannose is a disaccharide compound, which is a synthetic carbohydrate derived from the enzymatic or chemical glycosylation processes. It consists of glucose and mannose units linked through a glycosidic bond. The compound is sourced through advanced synthetic methodologies involving specific glycosyltransferases or chemical catalysts that facilitate the precise attachment of these sugar moieties.

Formula: C₁₂H₂₂O₁₁

Purity: Min. 95%

Molecular weight: 342.3 g/mol

Ref: 3D-QAA76161