CAS 157610-84-9
:N-Methyl-5-isoquinolinemethanamine
Description:
N-Methyl-5-isoquinolinemethanamine, identified by its CAS number 157610-84-9, is a chemical compound that belongs to the class of isoquinoline derivatives. It features a methyl group attached to the nitrogen atom of the isoquinoline structure, which contributes to its unique properties. This compound is characterized by its aromatic isoquinoline ring, which imparts stability and potential biological activity. N-Methyl-5-isoquinolinemethanamine may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its solubility, reactivity, and interaction with biological systems can vary based on the functional groups present and the overall molecular structure. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in pharmaceuticals or as a research tool. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies are often necessary to fully elucidate its properties and applications.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c1-12-7-9-3-2-4-10-8-13-6-5-11(9)10/h2-6,8,12H,7H2,1H3
InChI key:InChIKey=QMEHQGMKUUTMCP-UHFFFAOYSA-N
SMILES:C(NC)C=1C2=C(C=CC1)C=NC=C2
Synonyms:- (Isoquinolin-5-ylmethyl)(methyl)amine
- 1-(isoquinolin-5-yl)-N-methylmethanamine
- 5-Isoquinolinemethanamine, N-methyl-
- N-(isoquinolin-5-ylmethyl)-N-methylamine
- N-Methyl-5-isoquinolinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
