CymitQuimica logo

CAS 1577-62-4

:

N-trifluoroacetyl-L-cysteine methyl ester

Description:
N-trifluoroacetyl-L-cysteine methyl ester is a chemical compound characterized by its structure, which includes a trifluoroacetyl group attached to the amino acid cysteine, with a methyl ester functional group. This compound is typically used in biochemical research and synthesis due to its ability to modify thiol groups in proteins and peptides, making it valuable in studies involving protein structure and function. The trifluoroacetyl group enhances the lipophilicity and stability of the molecule, while the methyl ester provides a means for further chemical modifications. N-trifluoroacetyl-L-cysteine methyl ester is generally a white to off-white solid and is soluble in organic solvents. Its reactivity is influenced by the presence of the thiol group, which can participate in various chemical reactions, including nucleophilic attacks and disulfide bond formation. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, it serves as an important tool in the field of organic and medicinal chemistry.
Formula:C6H8F3NO3S
InChI:InChI=1/C6H8F3NO3S/c1-13-4(11)3(2-14)10-5(12)6(7,8)9/h3,14H,2H2,1H3,(H,10,12)
InChI key:VWGSQMAKRLENER-VKHMYHEASA-N
SMILES:COC(=O)C(CS)N=C(C(F)(F)F)O
Synonyms:
  • methyl N-(trifluoroacetyl)cysteinate
Found 2 products.