CAS 157701-72-9

2-Fluoro-4-nitrobenzaldehyde

Description:

2-Fluoro-4-nitrobenzaldehyde is an aromatic compound characterized by the presence of both a fluorine atom and a nitro group attached to a benzaldehyde structure. Its molecular formula is C7H4FNO3, indicating it contains seven carbon atoms, four hydrogen atoms, one fluorine atom, one nitrogen atom, and three oxygen atoms. The compound features a benzene ring with a formyl group (-CHO) at one position and a nitro group (-NO2) and a fluoro group (-F) at the 2 and 4 positions, respectively. This substitution pattern contributes to its unique reactivity and properties, making it useful in various chemical syntheses and applications, particularly in the field of organic chemistry. The presence of the electron-withdrawing nitro group enhances the electrophilic character of the aromatic ring, facilitating further chemical reactions. Additionally, 2-Fluoro-4-nitrobenzaldehyde is typically a yellow to orange solid at room temperature and may exhibit moderate solubility in organic solvents. Safety precautions should be taken when handling this compound due to its potential toxicity and reactivity.

Formula: C₇H₄FNO₃

InChI: InChI=1/C7H4FNO3/c8-7-3-6(9(11)12)2-1-5(7)4-10/h1-4H

SMILES: c1cc(cc(c1C=O)F)N(=O)=O

Synonyms:

• Benzaldehyde, 2-Fluoro-4-Nitro-

Benzaldehyde, 2-fluoro-4-nitro-

CAS: 157701-72-9

Formula: C₇H₄FNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 169.1100

Ref: IN-DA001PMW

2-Fluoro-4-nitrobenzaldehyde

CAS: 157701-72-9

2-Fluoro-4-nitrobenzaldehyde

Formula: C₇H₄FNO₃

Purity: 97%

Color and Shape: off-white crystalline solid

Molecular weight: 169.11g/mol

Ref: 54-PC57031

2-Fluoro-4-nitrobenzaldehyde

CAS: 157701-72-9

Formula: C₇H₄FNO₃

Purity: 98%

Color and Shape: Solid, Light yellow powder

Molecular weight: 169.111

Ref: 10-F076335